About methyl 3-oxo-2-phenylbutanoate
methyl 3-oxo-2-phenylbutanoate (PubChem CID 13096216) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is methyl 3-oxo-2-phenylbutanoate.
Molecular Properties
| Compound Name | methyl 3-oxo-2-phenylbutanoate |
| PubChem CID | 13096216 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | methyl 3-oxo-2-phenylbutanoate |
| SMILES | COC(=O)C(C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C11H12O3/c1-8(12)10(11(13)14-2)9-6-4-3-5-7-9/h3-7,10H,1-2H3 |
| InChIKey | CYSACHQWYQYLIG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-oxo-2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-oxo-2-phenylbutanoate?
The IUPAC name of methyl 3-oxo-2-phenylbutanoate (CID 13096216) is methyl 3-oxo-2-phenylbutanoate.
What is the SMILES notation for methyl 3-oxo-2-phenylbutanoate?
The canonical SMILES for methyl 3-oxo-2-phenylbutanoate is COC(=O)C(C(C)=O)c1ccccc1.
What is the InChIKey of methyl 3-oxo-2-phenylbutanoate?
The InChIKey is CYSACHQWYQYLIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c1-8(12)10(11(13)14-2)9-6-4-3-5-7-9/h3-7,10H,1-2H3.
What are the key properties of methyl 3-oxo-2-phenylbutanoate?
methyl 3-oxo-2-phenylbutanoate has a molecular weight of 192.21 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-oxo-2-phenylbutanoate is sourced from PubChem (CID 13096216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).