About N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine
N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine (PubChem CID 130964396) has the molecular formula C10H15NO2S
and a molecular weight of 213.30 g/mol. Its IUPAC name is N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine.
Molecular Properties
| Compound Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine |
| PubChem CID | 130964396 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine |
| SMILES | O=S1(=O)CC(NC2CC3CC=CC32)C1 |
| InChI | InChI=1S/C10H15NO2S/c12-14(13)5-8(6-14)11-10-4-7-2-1-3-9(7)10/h1,3,7-11H,2,4-6H2 |
| InChIKey | DRWXKUMKUMAIBW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine?
The IUPAC name of N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine (CID 130964396) is N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine.
What is the SMILES notation for N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine?
The canonical SMILES for N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine is O=S1(=O)CC(NC2CC3CC=CC32)C1.
What is the InChIKey of N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine?
The InChIKey is DRWXKUMKUMAIBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2S/c12-14(13)5-8(6-14)11-10-4-7-2-1-3-9(7)10/h1,3,7-11H,2,4-6H2.
What are the key properties of N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine?
N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine has a molecular weight of 213.30 g/mol, XLogP of 0.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bicyclo[3.2.0]hept-3-enyl)-1,1-dioxothietan-3-amine is sourced from PubChem (CID 130964396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).