About 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine
3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine (PubChem CID 130964545) has the molecular formula C10H15N3S
and a molecular weight of 209.32 g/mol. Its IUPAC name is 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine |
| PubChem CID | 130964545 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine |
| SMILES | CC1(C)SCC1Nc1cccnc1N |
| InChI | InChI=1S/C10H15N3S/c1-10(2)8(6-14-10)13-7-4-3-5-12-9(7)11/h3-5,8,13H,6H2,1-2H3,(H2,11,12) |
| InChIKey | AMWJGGMXPFLJCL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine?
The IUPAC name of 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine (CID 130964545) is 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine.
What is the SMILES notation for 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine?
The canonical SMILES for 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine is CC1(C)SCC1Nc1cccnc1N.
What is the InChIKey of 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine?
The InChIKey is AMWJGGMXPFLJCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3S/c1-10(2)8(6-14-10)13-7-4-3-5-12-9(7)11/h3-5,8,13H,6H2,1-2H3,(H2,11,12).
What are the key properties of 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine?
3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine has a molecular weight of 209.32 g/mol, XLogP of 1.97, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(2,2-dimethylthietan-3-yl)pyridine-2,3-diamine is sourced from PubChem (CID 130964545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).