About trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine
trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine (PubChem CID 130964805) has the molecular formula C10H12Cl2N2
and a molecular weight of 231.13 g/mol. Its IUPAC name is trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine.
Molecular Properties
| Compound Name | trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine |
| PubChem CID | 130964805 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine |
| SMILES | C[C@@H]1C[C@H]1NCc1ccnc(Cl)c1Cl |
| InChI | InChI=1S/C10H12Cl2N2/c1-6-4-8(6)14-5-7-2-3-13-10(12)9(7)11/h2-3,6,8,14H,4-5H2,1H3/t6-,8-/m1/s1 |
| InChIKey | HOGNPYRSCTXFKS-HTRCEHHLSA-N |
| XLogP | 2.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine?
The IUPAC name of trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine (CID 130964805) is trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine.
What is the SMILES notation for trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine?
The canonical SMILES for trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine is C[C@@H]1C[C@H]1NCc1ccnc(Cl)c1Cl.
What is the InChIKey of trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine?
The InChIKey is HOGNPYRSCTXFKS-HTRCEHHLSA-N. The full InChI is InChI=1S/C10H12Cl2N2/c1-6-4-8(6)14-5-7-2-3-13-10(12)9(7)11/h2-3,6,8,14H,4-5H2,1H3/t6-,8-/m1/s1.
What are the key properties of trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine?
trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine has a molecular weight of 231.13 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-N-[(2,3-dichloro-4-pyridinyl)methyl]-2-methylcyclopropan-1-amine is sourced from PubChem (CID 130964805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).