C10H16O2 — CID 130965036
(3aS,7aS)-7a-hydroxy-3-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 130965036) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3aS,7aS)-7a-hydroxy-3-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (3aS,7aS)-7a-hydroxy-3-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 130965036 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3aS,7aS)-7a-hydroxy-3-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC1CC[C@@]2(O)CCCC(=O)[C@@H]12 |
| InChI | InChI=1S/C10H16O2/c1-7-4-6-10(12)5-2-3-8(11)9(7)10/h7,9,12H,2-6H2,1H3/t7?,9-,10+/m1/s1 |
| InChIKey | KDKJRIRUXDLJAQ-MKSVKPQVSA-N |
| XLogP | 1.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |