About (E)-3,4-dimethylpent-2-enenitrile
(E)-3,4-dimethylpent-2-enenitrile (PubChem CID 13096538) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is (E)-3,4-dimethylpent-2-enenitrile.
Molecular Properties
| Compound Name | (E)-3,4-dimethylpent-2-enenitrile |
| PubChem CID | 13096538 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | (E)-3,4-dimethylpent-2-enenitrile |
| SMILES | C/C(=C\C#N)C(C)C |
| InChI | InChI=1S/C7H11N/c1-6(2)7(3)4-5-8/h4,6H,1-3H3/b7-4+ |
| InChIKey | JNOUNLLJKNUPNS-QPJJXVBHSA-N |
| XLogP | 2.11 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-3,4-dimethylpent-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,4-dimethylpent-2-enenitrile?
The IUPAC name of (E)-3,4-dimethylpent-2-enenitrile (CID 13096538) is (E)-3,4-dimethylpent-2-enenitrile.
What is the SMILES notation for (E)-3,4-dimethylpent-2-enenitrile?
The canonical SMILES for (E)-3,4-dimethylpent-2-enenitrile is C/C(=C\C#N)C(C)C.
What is the InChIKey of (E)-3,4-dimethylpent-2-enenitrile?
The InChIKey is JNOUNLLJKNUPNS-QPJJXVBHSA-N. The full InChI is InChI=1S/C7H11N/c1-6(2)7(3)4-5-8/h4,6H,1-3H3/b7-4+.
What are the key properties of (E)-3,4-dimethylpent-2-enenitrile?
(E)-3,4-dimethylpent-2-enenitrile has a molecular weight of 109.17 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,4-dimethylpent-2-enenitrile is sourced from PubChem (CID 13096538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).