C18H26N2 — CID 13096730
N,N-dipropyl-6,7,8,9-tetrahydro-3H-benzo[e]indol-8-amine (PubChem CID 13096730) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N,N-dipropyl-6,7,8,9-tetrahydro-3H-benzo[e]indol-8-amine.
| Compound Name | N,N-dipropyl-6,7,8,9-tetrahydro-3H-benzo[e]indol-8-amine |
|---|---|
| PubChem CID | 13096730 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N,N-dipropyl-6,7,8,9-tetrahydro-3H-benzo[e]indol-8-amine |
| SMILES | CCCN(CCC)C1CCc2ccc3[nH]ccc3c2C1 |
| InChI | InChI=1S/C18H26N2/c1-3-11-20(12-4-2)15-7-5-14-6-8-18-16(9-10-19-18)17(14)13-15/h6,8-10,15,19H,3-5,7,11-13H2,1-2H3 |
| InChIKey | GKDJCOLVXBCNNK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |