About 2-(bromomethyl)-1-benzothiophene-3,7-diol
2-(bromomethyl)-1-benzothiophene-3,7-diol (PubChem CID 130969357) has the molecular formula C9H7BrO2S
and a molecular weight of 259.12 g/mol. Its IUPAC name is 2-(bromomethyl)-1-benzothiophene-3,7-diol.
Molecular Properties
| Compound Name | 2-(bromomethyl)-1-benzothiophene-3,7-diol |
| PubChem CID | 130969357 |
| Molecular Formula | C9H7BrO2S |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | 2-(bromomethyl)-1-benzothiophene-3,7-diol |
| SMILES | Oc1c(CBr)sc2c(O)cccc12 |
| InChI | InChI=1S/C9H7BrO2S/c10-4-7-8(12)5-2-1-3-6(11)9(5)13-7/h1-3,11-12H,4H2 |
| InChIKey | YIBHOYBAUPLYPM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-1-benzothiophene-3,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-1-benzothiophene-3,7-diol?
The IUPAC name of 2-(bromomethyl)-1-benzothiophene-3,7-diol (CID 130969357) is 2-(bromomethyl)-1-benzothiophene-3,7-diol.
What is the SMILES notation for 2-(bromomethyl)-1-benzothiophene-3,7-diol?
The canonical SMILES for 2-(bromomethyl)-1-benzothiophene-3,7-diol is Oc1c(CBr)sc2c(O)cccc12.
What is the InChIKey of 2-(bromomethyl)-1-benzothiophene-3,7-diol?
The InChIKey is YIBHOYBAUPLYPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrO2S/c10-4-7-8(12)5-2-1-3-6(11)9(5)13-7/h1-3,11-12H,4H2.
What are the key properties of 2-(bromomethyl)-1-benzothiophene-3,7-diol?
2-(bromomethyl)-1-benzothiophene-3,7-diol has a molecular weight of 259.12 g/mol, XLogP of 3.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-1-benzothiophene-3,7-diol is sourced from PubChem (CID 130969357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).