C9H6F2S2 — CID 130969665
2,6-difluoro-5-methylsulfanyl-1-benzothiophene (PubChem CID 130969665) has the molecular formula C9H6F2S2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2,6-difluoro-5-methylsulfanyl-1-benzothiophene.
| Compound Name | 2,6-difluoro-5-methylsulfanyl-1-benzothiophene |
|---|---|
| PubChem CID | 130969665 |
| Molecular Formula | C9H6F2S2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | 2,6-difluoro-5-methylsulfanyl-1-benzothiophene |
| SMILES | CSc1cc2cc(F)sc2cc1F |
| InChI | InChI=1S/C9H6F2S2/c1-12-8-2-5-3-9(11)13-7(5)4-6(8)10/h2-4H,1H3 |
| InChIKey | PZOXZEUDDBEUKC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |