About 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine
3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine (PubChem CID 130969790) has the molecular formula C7H11FN2S
and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine |
| PubChem CID | 130969790 |
| Molecular Formula | C7H11FN2S |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine |
| SMILES | CC(CN)C(F)c1ccsn1 |
| InChI | InChI=1S/C7H11FN2S/c1-5(4-9)7(8)6-2-3-11-10-6/h2-3,5,7H,4,9H2,1H3 |
| InChIKey | MAYVQHWBUKSCIL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine?
The IUPAC name of 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine (CID 130969790) is 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine.
What is the SMILES notation for 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine?
The canonical SMILES for 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine is CC(CN)C(F)c1ccsn1.
What is the InChIKey of 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine?
The InChIKey is MAYVQHWBUKSCIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FN2S/c1-5(4-9)7(8)6-2-3-11-10-6/h2-3,5,7H,4,9H2,1H3.
What are the key properties of 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine?
3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine has a molecular weight of 174.24 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-methyl-3-(1,2-thiazol-3-yl)propan-1-amine is sourced from PubChem (CID 130969790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).