C11H12O2 — CID 130971234
(1R,2S,6R,7R,8S)-6-hydroxytricyclo[6.2.1.02,7]undeca-4,9-dien-3-one (PubChem CID 130971234) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is (1R,2S,6R,7R,8S)-6-hydroxytricyclo[6.2.1.02,7]undeca-4,9-dien-3-one.
| Compound Name | (1R,2S,6R,7R,8S)-6-hydroxytricyclo[6.2.1.02,7]undeca-4,9-dien-3-one |
|---|---|
| PubChem CID | 130971234 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (1R,2S,6R,7R,8S)-6-hydroxytricyclo[6.2.1.02,7]undeca-4,9-dien-3-one |
| SMILES | O=C1C=C[C@@H](O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C11H12O2/c12-8-3-4-9(13)11-7-2-1-6(5-7)10(8)11/h1-4,6-8,10-12H,5H2/t6-,7+,8-,10+,11-/m1/s1 |
| InChIKey | WULXBAZKDROCDP-MWRVJPDDSA-N |
| XLogP | 0.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|