C8H9N3S — CID 130971655
1-benzothiophene-3,4,6-triamine (PubChem CID 130971655) has the molecular formula C8H9N3S and a molecular weight of 179.25 g/mol. Its IUPAC name is 1-benzothiophene-3,4,6-triamine.
| Compound Name | 1-benzothiophene-3,4,6-triamine |
|---|---|
| PubChem CID | 130971655 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 1-benzothiophene-3,4,6-triamine |
| SMILES | Nc1cc(N)c2c(N)csc2c1 |
| InChI | InChI=1S/C8H9N3S/c9-4-1-5(10)8-6(11)3-12-7(8)2-4/h1-3H,9-11H2 |
| InChIKey | QUELXPNCCRJNRO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|