About 1-benzothiophene-3,4,6-triamine
1-benzothiophene-3,4,6-triamine (PubChem CID 130971655) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is 1-benzothiophene-3,4,6-triamine.
Molecular Properties
| Compound Name | 1-benzothiophene-3,4,6-triamine |
| PubChem CID | 130971655 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 1-benzothiophene-3,4,6-triamine |
| SMILES | Nc1cc(N)c2c(N)csc2c1 |
| InChI | InChI=1S/C8H9N3S/c9-4-1-5(10)8-6(11)3-12-7(8)2-4/h1-3H,9-11H2 |
| InChIKey | QUELXPNCCRJNRO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophene-3,4,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene-3,4,6-triamine?
The IUPAC name of 1-benzothiophene-3,4,6-triamine (CID 130971655) is 1-benzothiophene-3,4,6-triamine.
What is the SMILES notation for 1-benzothiophene-3,4,6-triamine?
The canonical SMILES for 1-benzothiophene-3,4,6-triamine is Nc1cc(N)c2c(N)csc2c1.
What is the InChIKey of 1-benzothiophene-3,4,6-triamine?
The InChIKey is QUELXPNCCRJNRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S/c9-4-1-5(10)8-6(11)3-12-7(8)2-4/h1-3H,9-11H2.
What are the key properties of 1-benzothiophene-3,4,6-triamine?
1-benzothiophene-3,4,6-triamine has a molecular weight of 179.25 g/mol, XLogP of 1.65, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene-3,4,6-triamine is sourced from PubChem (CID 130971655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).