About N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide
N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide (PubChem CID 130973897) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide |
| PubChem CID | 130973897 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCC1=CCOCC1 |
| InChI | InChI=1S/C11H19NO2/c1-11(2,3)10(13)12-8-9-4-6-14-7-5-9/h4H,5-8H2,1-3H3,(H,12,13) |
| InChIKey | LXIIOVOJHXUDDO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide?
The IUPAC name of N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide (CID 130973897) is N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide is CC(C)(C)C(=O)NCC1=CCOCC1.
What is the InChIKey of N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide?
The InChIKey is LXIIOVOJHXUDDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-11(2,3)10(13)12-8-9-4-6-14-7-5-9/h4H,5-8H2,1-3H3,(H,12,13).
What are the key properties of N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide?
N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide has a molecular weight of 197.28 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 130973897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).