About (3-acetylphenyl) carbonochloridate
(3-acetylphenyl) carbonochloridate (PubChem CID 13097700) has the molecular formula C9H7ClO3
and a molecular weight of 198.60 g/mol. Its IUPAC name is (3-acetylphenyl) carbonochloridate.
Molecular Properties
| Compound Name | (3-acetylphenyl) carbonochloridate |
| PubChem CID | 13097700 |
| Molecular Formula | C9H7ClO3 |
| Molecular Weight | 198.60 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | (3-acetylphenyl) carbonochloridate |
| SMILES | CC(=O)c1cccc(OC(=O)Cl)c1 |
| InChI | InChI=1S/C9H7ClO3/c1-6(11)7-3-2-4-8(5-7)13-9(10)12/h2-5H,1H3 |
| InChIKey | DXCMPQOMRUVQJT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.60 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (3-acetylphenyl) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetylphenyl) carbonochloridate?
The IUPAC name of (3-acetylphenyl) carbonochloridate (CID 13097700) is (3-acetylphenyl) carbonochloridate.
What is the SMILES notation for (3-acetylphenyl) carbonochloridate?
The canonical SMILES for (3-acetylphenyl) carbonochloridate is CC(=O)c1cccc(OC(=O)Cl)c1.
What is the InChIKey of (3-acetylphenyl) carbonochloridate?
The InChIKey is DXCMPQOMRUVQJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO3/c1-6(11)7-3-2-4-8(5-7)13-9(10)12/h2-5H,1H3.
What are the key properties of (3-acetylphenyl) carbonochloridate?
(3-acetylphenyl) carbonochloridate has a molecular weight of 198.60 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetylphenyl) carbonochloridate is sourced from PubChem (CID 13097700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).