C10H12INO — CID 130977729
[(3S)-5-iodo-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol (PubChem CID 130977729) has the molecular formula C10H12INO and a molecular weight of 289.12 g/mol. Its IUPAC name is [(3S)-5-iodo-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol.
| Compound Name | [(3S)-5-iodo-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol |
|---|---|
| PubChem CID | 130977729 |
| Molecular Formula | C10H12INO |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | [(3S)-5-iodo-1,2,3,4-tetrahydroisoquinolin-3-yl]methanol |
| SMILES | OC[C@@H]1Cc2c(I)cccc2CN1 |
| InChI | InChI=1S/C10H12INO/c11-10-3-1-2-7-5-12-8(6-13)4-9(7)10/h1-3,8,12-13H,4-6H2/t8-/m0/s1 |
| InChIKey | SXMXYKGLTVJBOV-QMMMGPOBSA-N |
| XLogP | 1.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|