C8H13NO3 — CID 130978090
(5R,8aR)-8-hydroxy-5-methyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 130978090) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is (5R,8aR)-8-hydroxy-5-methyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (5R,8aR)-8-hydroxy-5-methyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 130978090 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (5R,8aR)-8-hydroxy-5-methyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | C[C@@H]1CCC(O)[C@H]2COC(=O)N12 |
| InChI | InChI=1S/C8H13NO3/c1-5-2-3-7(10)6-4-12-8(11)9(5)6/h5-7,10H,2-4H2,1H3/t5-,6-,7?/m1/s1 |
| InChIKey | ZIYZOGYFSYPJGL-CQMSUOBXSA-N |
| XLogP | 0.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |