C9H15N3S — CID 130978157
4-(1H-pyrazol-5-ylmethyl)-1,4-thiazepane (PubChem CID 130978157) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 4-(1H-pyrazol-5-ylmethyl)-1,4-thiazepane.
| Compound Name | 4-(1H-pyrazol-5-ylmethyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 130978157 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 4-(1H-pyrazol-5-ylmethyl)-1,4-thiazepane |
| SMILES | c1cc(CN2CCCSCC2)[nH]n1 |
| InChI | InChI=1S/C9H15N3S/c1-4-12(5-7-13-6-1)8-9-2-3-10-11-9/h2-3H,1,4-8H2,(H,10,11) |
| InChIKey | VTVMDHPUSKIJKL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |