C15H8F5NO3 — CID 13097835
2,3,4,5,6-pentafluoro-N-(3-hydroxy-1,3-dihydro-2-benzofuran-1-yl)benzamide (PubChem CID 13097835) has the molecular formula C15H8F5NO3 and a molecular weight of 345.22 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(3-hydroxy-1,3-dihydro-2-benzofuran-1-yl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(3-hydroxy-1,3-dihydro-2-benzofuran-1-yl)benzamide |
|---|---|
| PubChem CID | 13097835 |
| Molecular Formula | C15H8F5NO3 |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(3-hydroxy-1,3-dihydro-2-benzofuran-1-yl)benzamide |
| SMILES | O=C(NC1OC(O)c2ccccc21)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H8F5NO3/c16-8-7(9(17)11(19)12(20)10(8)18)13(22)21-14-5-3-1-2-4-6(5)15(23)24-14/h1-4,14-15,23H,(H,21,22) |
| InChIKey | BFOGMUSODBCYKG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|