C12H23N — CID 130978480
(3aR,7aR)-1-butan-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 130978480) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (3aR,7aR)-1-butan-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | (3aR,7aR)-1-butan-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 130978480 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (3aR,7aR)-1-butan-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | CCC(C)N1CC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C12H23N/c1-3-10(2)13-9-8-11-6-4-5-7-12(11)13/h10-12H,3-9H2,1-2H3/t10?,11-,12-/m1/s1 |
| InChIKey | MFVWKMKQGCPWNF-PQDIPPBSSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |