C8H14N4OS — CID 130979599
5-(7-methyl-1,4-thiazepan-4-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 130979599) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is 5-(7-methyl-1,4-thiazepan-4-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(7-methyl-1,4-thiazepan-4-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 130979599 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 5-(7-methyl-1,4-thiazepan-4-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC1CCN(c2nnc(N)o2)CCS1 |
| InChI | InChI=1S/C8H14N4OS/c1-6-2-3-12(4-5-14-6)8-11-10-7(9)13-8/h6H,2-5H2,1H3,(H2,9,10) |
| InChIKey | DVNPBIIMTKCPBR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |