About (2S)-2-bromothiolane 1-oxide
(2S)-2-bromothiolane 1-oxide (PubChem CID 130979840) has the molecular formula C4H7BrOS
and a molecular weight of 183.07 g/mol. Its IUPAC name is (2S)-2-bromothiolane 1-oxide.
Molecular Properties
| Compound Name | (2S)-2-bromothiolane 1-oxide |
| PubChem CID | 130979840 |
| Molecular Formula | C4H7BrOS |
| Molecular Weight | 183.07 g/mol |
| Exact Mass | 181.94 |
| IUPAC Name | (2S)-2-bromothiolane 1-oxide |
| SMILES | O=S1CCC[C@@H]1Br |
| InChI | InChI=1S/C4H7BrOS/c5-4-2-1-3-7(4)6/h4H,1-3H2/t4-,7?/m1/s1 |
| InChIKey | XGIMZOBLXIEVEV-AWGJQOPUSA-N |
| XLogP | 1.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.07 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-bromothiolane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-bromothiolane 1-oxide?
The IUPAC name of (2S)-2-bromothiolane 1-oxide (CID 130979840) is (2S)-2-bromothiolane 1-oxide.
What is the SMILES notation for (2S)-2-bromothiolane 1-oxide?
The canonical SMILES for (2S)-2-bromothiolane 1-oxide is O=S1CCC[C@@H]1Br.
What is the InChIKey of (2S)-2-bromothiolane 1-oxide?
The InChIKey is XGIMZOBLXIEVEV-AWGJQOPUSA-N. The full InChI is InChI=1S/C4H7BrOS/c5-4-2-1-3-7(4)6/h4H,1-3H2/t4-,7?/m1/s1.
What are the key properties of (2S)-2-bromothiolane 1-oxide?
(2S)-2-bromothiolane 1-oxide has a molecular weight of 183.07 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-bromothiolane 1-oxide is sourced from PubChem (CID 130979840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).