C6H11O7P — CID 130980003
[(2S,5S)-2,3-dihydroxy-6-oxabicyclo[3.1.1]heptan-7-yl] dihydrogen phosphate (PubChem CID 130980003) has the molecular formula C6H11O7P and a molecular weight of 226.12 g/mol. Its IUPAC name is [(2S,5S)-2,3-dihydroxy-6-oxabicyclo[3.1.1]heptan-7-yl] dihydrogen phosphate.
| Compound Name | [(2S,5S)-2,3-dihydroxy-6-oxabicyclo[3.1.1]heptan-7-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 130980003 |
| Molecular Formula | C6H11O7P |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | [(2S,5S)-2,3-dihydroxy-6-oxabicyclo[3.1.1]heptan-7-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC1C2O[C@H]1CC(O)[C@@H]2O |
| InChI | InChI=1S/C6H11O7P/c7-2-1-3-5(13-14(9,10)11)6(12-3)4(2)8/h2-8H,1H2,(H2,9,10,11)/t2?,3-,4-,5?,6?/m0/s1 |
| InChIKey | JOGKDDFANICXQE-UZJJNQGWSA-N |
| XLogP | -1.64 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|