C9H9BrOS2 — CID 130981620
1-[2,3-bis(sulfanyl)phenyl]-2-bromopropan-1-one (PubChem CID 130981620) has the molecular formula C9H9BrOS2 and a molecular weight of 277.21 g/mol. Its IUPAC name is 1-[2,3-bis(sulfanyl)phenyl]-2-bromopropan-1-one.
| Compound Name | 1-[2,3-bis(sulfanyl)phenyl]-2-bromopropan-1-one |
|---|---|
| PubChem CID | 130981620 |
| Molecular Formula | C9H9BrOS2 |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 275.93 |
| IUPAC Name | 1-[2,3-bis(sulfanyl)phenyl]-2-bromopropan-1-one |
| SMILES | CC(Br)C(=O)c1cccc(S)c1S |
| InChI | InChI=1S/C9H9BrOS2/c1-5(10)8(11)6-3-2-4-7(12)9(6)13/h2-5,12-13H,1H3 |
| InChIKey | KPAMLGUMIPKDCX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|