C8H9Br2N3O — CID 13098166
4-(3,5-dibromopyrazin-2-yl)morpholine (PubChem CID 13098166) has the molecular formula C8H9Br2N3O and a molecular weight of 322.99 g/mol. Its IUPAC name is 4-(3,5-dibromopyrazin-2-yl)morpholine.
| Compound Name | 4-(3,5-dibromopyrazin-2-yl)morpholine |
|---|---|
| PubChem CID | 13098166 |
| Molecular Formula | C8H9Br2N3O |
| Molecular Weight | 322.99 g/mol |
| Exact Mass | 320.91 |
| IUPAC Name | 4-(3,5-dibromopyrazin-2-yl)morpholine |
| SMILES | Brc1cnc(N2CCOCC2)c(Br)n1 |
| InChI | InChI=1S/C8H9Br2N3O/c9-6-5-11-8(7(10)12-6)13-1-3-14-4-2-13/h5H,1-4H2 |
| InChIKey | ORJABSJVKHTTMZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.99 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |