C7H5F4NO — CID 130982314
2-(difluoromethoxy)-3,6-difluoroaniline (PubChem CID 130982314) has the molecular formula C7H5F4NO and a molecular weight of 195.12 g/mol. Its IUPAC name is 2-(difluoromethoxy)-3,6-difluoroaniline.
| Compound Name | 2-(difluoromethoxy)-3,6-difluoroaniline |
|---|---|
| PubChem CID | 130982314 |
| Molecular Formula | C7H5F4NO |
| Molecular Weight | 195.12 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 2-(difluoromethoxy)-3,6-difluoroaniline |
| SMILES | Nc1c(F)ccc(F)c1OC(F)F |
| InChI | InChI=1S/C7H5F4NO/c8-3-1-2-4(9)6(5(3)12)13-7(10)11/h1-2,7H,12H2 |
| InChIKey | LLIGWFCTGOEOSB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|