C9H6Br2OS — CID 130982936
(5,7-dibromo-1-benzothiophen-2-yl)methanol (PubChem CID 130982936) has the molecular formula C9H6Br2OS and a molecular weight of 322.02 g/mol. Its IUPAC name is (5,7-dibromo-1-benzothiophen-2-yl)methanol.
| Compound Name | (5,7-dibromo-1-benzothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 130982936 |
| Molecular Formula | C9H6Br2OS |
| Molecular Weight | 322.02 g/mol |
| Exact Mass | 319.85 |
| IUPAC Name | (5,7-dibromo-1-benzothiophen-2-yl)methanol |
| SMILES | OCc1cc2cc(Br)cc(Br)c2s1 |
| InChI | InChI=1S/C9H6Br2OS/c10-6-1-5-2-7(4-12)13-9(5)8(11)3-6/h1-3,12H,4H2 |
| InChIKey | PIKKTUNPGXMLBW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.02 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |