C12H21NS — CID 130985030
2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ylmethyl)prop-2-ene-1-thiol (PubChem CID 130985030) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is 2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ylmethyl)prop-2-ene-1-thiol.
| Compound Name | 2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ylmethyl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 130985030 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ylmethyl)prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN1CC2CCCCC2C1 |
| InChI | InChI=1S/C12H21NS/c1-10(9-14)6-13-7-11-4-2-3-5-12(11)8-13/h11-12,14H,1-9H2 |
| InChIKey | AGBMCUYDZDGLML-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|