C4H4Cl4O — CID 130986352
(2S,3S,4S,5S)-2,3,4,5-tetrachlorooxolane (PubChem CID 130986352) has the molecular formula C4H4Cl4O and a molecular weight of 209.89 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2,3,4,5-tetrachlorooxolane.
| Compound Name | (2S,3S,4S,5S)-2,3,4,5-tetrachlorooxolane |
|---|---|
| PubChem CID | 130986352 |
| Molecular Formula | C4H4Cl4O |
| Molecular Weight | 209.89 g/mol |
| Exact Mass | 207.90 |
| IUPAC Name | (2S,3S,4S,5S)-2,3,4,5-tetrachlorooxolane |
| SMILES | Cl[C@H]1[C@H](Cl)[C@H](Cl)O[C@H]1Cl |
| InChI | InChI=1S/C4H4Cl4O/c5-1-2(6)4(8)9-3(1)7/h1-4H/t1-,2-,3+,4+/m0/s1 |
| InChIKey | YEGKLAWNZAYENJ-ORZLYADOSA-N |
| XLogP | 2.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.89 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|