About 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine
1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine (PubChem CID 130987230) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine |
| PubChem CID | 130987230 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine |
| SMILES | NC1(Cc2nncn2C2CC2)CC1 |
| InChI | InChI=1S/C9H14N4/c10-9(3-4-9)5-8-12-11-6-13(8)7-1-2-7/h6-7H,1-5,10H2 |
| InChIKey | IOOSBNKJQHUZCG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine?
The IUPAC name of 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine (CID 130987230) is 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine.
What is the SMILES notation for 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine?
The canonical SMILES for 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine is NC1(Cc2nncn2C2CC2)CC1.
What is the InChIKey of 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine?
The InChIKey is IOOSBNKJQHUZCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4/c10-9(3-4-9)5-8-12-11-6-13(8)7-1-2-7/h6-7H,1-5,10H2.
What are the key properties of 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine?
1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine has a molecular weight of 178.24 g/mol, XLogP of 0.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]cyclopropan-1-amine is sourced from PubChem (CID 130987230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).