C11H18BrNOS — CID 130987268
1-(5-bromo-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-methylsulfanylethanone (PubChem CID 130987268) has the molecular formula C11H18BrNOS and a molecular weight of 292.24 g/mol. Its IUPAC name is 1-(5-bromo-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-methylsulfanylethanone.
| Compound Name | 1-(5-bromo-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-methylsulfanylethanone |
|---|---|
| PubChem CID | 130987268 |
| Molecular Formula | C11H18BrNOS |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 1-(5-bromo-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-2-methylsulfanylethanone |
| SMILES | CSCC(=O)N1CC2CCC(Br)CC2C1 |
| InChI | InChI=1S/C11H18BrNOS/c1-15-7-11(14)13-5-8-2-3-10(12)4-9(8)6-13/h8-10H,2-7H2,1H3 |
| InChIKey | DUXCNFOZIPLBQT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|