About 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine
1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine (PubChem CID 130987503) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine |
| PubChem CID | 130987503 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine |
| SMILES | NC1(Cc2ncn[nH]2)CC1 |
| InChI | InChI=1S/C6H10N4/c7-6(1-2-6)3-5-8-4-9-10-5/h4H,1-3,7H2,(H,8,9,10) |
| InChIKey | UMTWVQDSQGBYHP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine?
The IUPAC name of 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine (CID 130987503) is 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine.
What is the SMILES notation for 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine?
The canonical SMILES for 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine is NC1(Cc2ncn[nH]2)CC1.
What is the InChIKey of 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine?
The InChIKey is UMTWVQDSQGBYHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4/c7-6(1-2-6)3-5-8-4-9-10-5/h4H,1-3,7H2,(H,8,9,10).
What are the key properties of 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine?
1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine has a molecular weight of 138.17 g/mol, XLogP of -0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-1,2,4-triazol-5-ylmethyl)cyclopropan-1-amine is sourced from PubChem (CID 130987503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).