C10H19NO2 — CID 130987505
[(1R,2R)-2-(oxepan-4-ylamino)cyclopropyl]methanol (PubChem CID 130987505) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is [(1R,2R)-2-(oxepan-4-ylamino)cyclopropyl]methanol.
| Compound Name | [(1R,2R)-2-(oxepan-4-ylamino)cyclopropyl]methanol |
|---|---|
| PubChem CID | 130987505 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | [(1R,2R)-2-(oxepan-4-ylamino)cyclopropyl]methanol |
| SMILES | OC[C@@H]1C[C@H]1NC1CCCOCC1 |
| InChI | InChI=1S/C10H19NO2/c12-7-8-6-10(8)11-9-2-1-4-13-5-3-9/h8-12H,1-7H2/t8-,9?,10+/m0/s1 |
| InChIKey | HMXJHBDQLKJDDP-DJBFQZMMSA-N |
| XLogP | 0.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |