C9H13NO — CID 130987526
(1S)-1-(4,6-dimethyl-3-pyridinyl)ethanol (PubChem CID 130987526) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (1S)-1-(4,6-dimethyl-3-pyridinyl)ethanol.
| Compound Name | (1S)-1-(4,6-dimethyl-3-pyridinyl)ethanol |
|---|---|
| PubChem CID | 130987526 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (1S)-1-(4,6-dimethyl-3-pyridinyl)ethanol |
| SMILES | Cc1cc(C)c([C@H](C)O)cn1 |
| InChI | InChI=1S/C9H13NO/c1-6-4-7(2)10-5-9(6)8(3)11/h4-5,8,11H,1-3H3/t8-/m0/s1 |
| InChIKey | NXTOPGUYVQVSQN-QMMMGPOBSA-N |
| XLogP | 1.75 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |