C11H15NO3 — CID 130987653
1-but-3-ynoyl-5-methylpiperidine-3-carboxylic acid (PubChem CID 130987653) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-but-3-ynoyl-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-but-3-ynoyl-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 130987653 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-but-3-ynoyl-5-methylpiperidine-3-carboxylic acid |
| SMILES | C#CCC(=O)N1CC(C)CC(C(=O)O)C1 |
| InChI | InChI=1S/C11H15NO3/c1-3-4-10(13)12-6-8(2)5-9(7-12)11(14)15/h1,8-9H,4-7H2,2H3,(H,14,15) |
| InChIKey | HBHCXRXHVWSSQO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|