C9H10ClNO — CID 130987856
[(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol (PubChem CID 130987856) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol.
| Compound Name | [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol |
|---|---|
| PubChem CID | 130987856 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol |
| SMILES | OC[C@H]1NCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H10ClNO/c10-7-2-1-6-4-11-9(5-12)8(6)3-7/h1-3,9,11-12H,4-5H2/t9-/m1/s1 |
| InChIKey | BTAQWYYCWMKYNG-SECBINFHSA-N |
| XLogP | 1.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |