About [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol
[(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol (PubChem CID 130987856) has the molecular formula C9H10ClNO
and a molecular weight of 183.64 g/mol. Its IUPAC name is [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol.
Molecular Properties
| Compound Name | [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol |
| PubChem CID | 130987856 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol |
| SMILES | OC[C@H]1NCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H10ClNO/c10-7-2-1-6-4-11-9(5-12)8(6)3-7/h1-3,9,11-12H,4-5H2/t9-/m1/s1 |
| InChIKey | BTAQWYYCWMKYNG-SECBINFHSA-N |
| XLogP | 1.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol?
The IUPAC name of [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol (CID 130987856) is [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol.
What is the SMILES notation for [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol?
The canonical SMILES for [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol is OC[C@H]1NCc2ccc(Cl)cc21.
What is the InChIKey of [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol?
The InChIKey is BTAQWYYCWMKYNG-SECBINFHSA-N. The full InChI is InChI=1S/C9H10ClNO/c10-7-2-1-6-4-11-9(5-12)8(6)3-7/h1-3,9,11-12H,4-5H2/t9-/m1/s1.
What are the key properties of [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol?
[(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol has a molecular weight of 183.64 g/mol, XLogP of 1.48, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-6-chloro-2,3-dihydro-1H-isoindol-1-yl]methanol is sourced from PubChem (CID 130987856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).