C14H25NO5 — CID 130989031
tert-butyl (4aR,8R,8aR)-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate (PubChem CID 130989031) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl (4aR,8R,8aR)-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate.
| Compound Name | tert-butyl (4aR,8R,8aR)-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 130989031 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | tert-butyl (4aR,8R,8aR)-8-hydroxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](O)[C@@H]2OC(C)(C)OC[C@H]21 |
| InChI | InChI=1S/C14H25NO5/c1-13(2,3)20-12(17)15-7-6-10(16)11-9(15)8-18-14(4,5)19-11/h9-11,16H,6-8H2,1-5H3/t9-,10-,11-/m1/s1 |
| InChIKey | IGQBZABSCORRLX-GMTAPVOTSA-N |
| XLogP | 1.51 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |