2-fluoro-2-(1,2-thiazol-5-yl)acetic acid

C5H4FNO2S — CID 130989408

IUPAC2-fluoro-2-(1,2-thiazol-5-yl)acetic acid
SMILESO=C(O)C(F)c1ccns1
InChIInChI=1S/C5H4FNO2S/c6-4(5(8)9)3-1-2-7-10-3/h1-2,4H,(H,8,9)
InChIKeyLYTGBISIKGMBJZ-UHFFFAOYSA-N
MW161.16 g/mol
LogP1.24
Rot. Bonds2

About 2-fluoro-2-(1,2-thiazol-5-yl)acetic acid

2-fluoro-2-(1,2-thiazol-5-yl)acetic acid (PubChem CID 130989408) has the molecular formula C5H4FNO2S and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-fluoro-2-(1,2-thiazol-5-yl)acetic acid.

Molecular Properties

Compound Name2-fluoro-2-(1,2-thiazol-5-yl)acetic acid
PubChem CID130989408
Molecular FormulaC5H4FNO2S
Molecular Weight161.16 g/mol
Exact Mass160.99
IUPAC Name2-fluoro-2-(1,2-thiazol-5-yl)acetic acid
SMILESO=C(O)C(F)c1ccns1
InChIInChI=1S/C5H4FNO2S/c6-4(5(8)9)3-1-2-7-10-3/h1-2,4H,(H,8,9)
InChIKeyLYTGBISIKGMBJZ-UHFFFAOYSA-N
XLogP1.24
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.16
LogP ≤ 51.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-fluoro-2-(1,2-thiazol-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-2-(1,2-thiazol-5-yl)acetic acid?
The IUPAC name of 2-fluoro-2-(1,2-thiazol-5-yl)acetic acid (CID 130989408) is 2-fluoro-2-(1,2-thiazol-5-yl)acetic acid.
What is the SMILES notation for 2-fluoro-2-(1,2-thiazol-5-yl)acetic acid?
The canonical SMILES for 2-fluoro-2-(1,2-thiazol-5-yl)acetic acid is O=C(O)C(F)c1ccns1.
What is the InChIKey of 2-fluoro-2-(1,2-thiazol-5-yl)acetic acid?
The InChIKey is LYTGBISIKGMBJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4FNO2S/c6-4(5(8)9)3-1-2-7-10-3/h1-2,4H,(H,8,9).
What are the key properties of 2-fluoro-2-(1,2-thiazol-5-yl)acetic acid?
2-fluoro-2-(1,2-thiazol-5-yl)acetic acid has a molecular weight of 161.16 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-(1,2-thiazol-5-yl)acetic acid is sourced from PubChem (CID 130989408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).