About N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine
N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine (PubChem CID 130991336) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine.
Molecular Properties
| Compound Name | N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine |
| PubChem CID | 130991336 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine |
| SMILES | C#CC(C)N(C)Cc1nc(C)no1 |
| InChI | InChI=1S/C9H13N3O/c1-5-7(2)12(4)6-9-10-8(3)11-13-9/h1,7H,6H2,2-4H3 |
| InChIKey | APKXVOUFKHLALP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine?
The IUPAC name of N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine (CID 130991336) is N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine.
What is the SMILES notation for N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine?
The canonical SMILES for N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine is C#CC(C)N(C)Cc1nc(C)no1.
What is the InChIKey of N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine?
The InChIKey is APKXVOUFKHLALP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c1-5-7(2)12(4)6-9-10-8(3)11-13-9/h1,7H,6H2,2-4H3.
What are the key properties of N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine?
N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine has a molecular weight of 179.22 g/mol, XLogP of 0.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]but-3-yn-2-amine is sourced from PubChem (CID 130991336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).