About (1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol
(1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol (PubChem CID 130991403) has the molecular formula C9H15NO
and a molecular weight of 153.23 g/mol. Its IUPAC name is (1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol.
Analyze (1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol?
The IUPAC name of (1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol (CID 130991403) is (1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol.
What is the SMILES notation for (1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol?
The canonical SMILES for (1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol is CN1[C@@H]2CC(O)C[C@H]1[C@@H]1C[C@@H]12.
What is the InChIKey of (1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol?
The InChIKey is YYPPBNNLZDCVKO-RQOWMOBWSA-N. The full InChI is InChI=1S/C9H15NO/c1-10-8-2-5(11)3-9(10)7-4-6(7)8/h5-9,11H,2-4H2,1H3/t5?,6-,7+,8+,9-.
What are the key properties of (1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol?
(1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol has a molecular weight of 153.23 g/mol, XLogP of 0.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S,4R,5S)-9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol is sourced from PubChem (CID 130991403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).