C11H12O2 — CID 130991835
(1S,3S,8R,10S)-8-methyl-9-oxatetracyclo[5.4.0.03,10.04,8]undec-5-en-2-one (PubChem CID 130991835) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is (1S,3S,8R,10S)-8-methyl-9-oxatetracyclo[5.4.0.03,10.04,8]undec-5-en-2-one.
| Compound Name | (1S,3S,8R,10S)-8-methyl-9-oxatetracyclo[5.4.0.03,10.04,8]undec-5-en-2-one |
|---|---|
| PubChem CID | 130991835 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (1S,3S,8R,10S)-8-methyl-9-oxatetracyclo[5.4.0.03,10.04,8]undec-5-en-2-one |
| SMILES | C[C@]12O[C@H]3C[C@@H]4C(=O)[C@H]3C1C=CC42 |
| InChI | InChI=1S/C11H12O2/c1-11-6-2-3-7(11)9-8(13-11)4-5(6)10(9)12/h2-3,5-9H,4H2,1H3/t5-,6?,7?,8-,9-,11+/m0/s1 |
| InChIKey | CPNPKQLIWPHUKM-AJPQBXADSA-N |
| XLogP | 1.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|