About 2-ethoxybutanenitrile
2-ethoxybutanenitrile (PubChem CID 13099193) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-ethoxybutanenitrile.
Molecular Properties
| Compound Name | 2-ethoxybutanenitrile |
| PubChem CID | 13099193 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 2-ethoxybutanenitrile |
| SMILES | CCOC(C#N)CC |
| InChI | InChI=1S/C6H11NO/c1-3-6(5-7)8-4-2/h6H,3-4H2,1-2H3 |
| InChIKey | GHMJXRLUKUMGSQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxybutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxybutanenitrile?
The IUPAC name of 2-ethoxybutanenitrile (CID 13099193) is 2-ethoxybutanenitrile.
What is the SMILES notation for 2-ethoxybutanenitrile?
The canonical SMILES for 2-ethoxybutanenitrile is CCOC(C#N)CC.
What is the InChIKey of 2-ethoxybutanenitrile?
The InChIKey is GHMJXRLUKUMGSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-3-6(5-7)8-4-2/h6H,3-4H2,1-2H3.
What are the key properties of 2-ethoxybutanenitrile?
2-ethoxybutanenitrile has a molecular weight of 113.16 g/mol, XLogP of 1.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybutanenitrile is sourced from PubChem (CID 13099193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).