C12H14O2 — CID 130992161
(1S,2R,6S,7S,8R)-6-hydroxy-4-methyltricyclo[6.2.1.02,7]undeca-4,9-dien-3-one (PubChem CID 130992161) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (1S,2R,6S,7S,8R)-6-hydroxy-4-methyltricyclo[6.2.1.02,7]undeca-4,9-dien-3-one.
| Compound Name | (1S,2R,6S,7S,8R)-6-hydroxy-4-methyltricyclo[6.2.1.02,7]undeca-4,9-dien-3-one |
|---|---|
| PubChem CID | 130992161 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (1S,2R,6S,7S,8R)-6-hydroxy-4-methyltricyclo[6.2.1.02,7]undeca-4,9-dien-3-one |
| SMILES | CC1=C[C@@H](O)[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C12H14O2/c1-6-4-9(13)10-7-2-3-8(5-7)11(10)12(6)14/h2-4,7-11,13H,5H2,1H3/t7-,8+,9+,10+,11+/m0/s1 |
| InChIKey | CHIUPHMXZMTGCK-VPJKUYQRSA-N |
| XLogP | 1.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|