C10H12F2N2 — CID 130992574
(3,3-difluorocyclobutyl)-pyridin-3-ylmethanamine (PubChem CID 130992574) has the molecular formula C10H12F2N2 and a molecular weight of 198.22 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-pyridin-3-ylmethanamine.
| Compound Name | (3,3-difluorocyclobutyl)-pyridin-3-ylmethanamine |
|---|---|
| PubChem CID | 130992574 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (3,3-difluorocyclobutyl)-pyridin-3-ylmethanamine |
| SMILES | NC(c1cccnc1)C1CC(F)(F)C1 |
| InChI | InChI=1S/C10H12F2N2/c11-10(12)4-8(5-10)9(13)7-2-1-3-14-6-7/h1-3,6,8-9H,4-5,13H2 |
| InChIKey | CZXXOSYRIQONRV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |