About spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one
spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one (PubChem CID 130992733) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one.
Molecular Properties
| Compound Name | spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one |
| PubChem CID | 130992733 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one |
| SMILES | O=C1COCC2(CCCC3CC32)N1 |
| InChI | InChI=1S/C10H15NO2/c12-9-5-13-6-10(11-9)3-1-2-7-4-8(7)10/h7-8H,1-6H2,(H,11,12) |
| InChIKey | DTMQGMHKQMEDEG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one?
The IUPAC name of spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one (CID 130992733) is spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one.
What is the SMILES notation for spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one?
The canonical SMILES for spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one is O=C1COCC2(CCCC3CC32)N1.
What is the InChIKey of spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one?
The InChIKey is DTMQGMHKQMEDEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c12-9-5-13-6-10(11-9)3-1-2-7-4-8(7)10/h7-8H,1-6H2,(H,11,12).
What are the key properties of spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one?
spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one has a molecular weight of 181.23 g/mol, XLogP of 0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[bicyclo[4.1.0]heptane-2,5'-morpholine]-3'-one is sourced from PubChem (CID 130992733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).