C12H14O — CID 13099278
(2S)-5,6,7,8-tetramethylidenebicyclo[2.2.2]octan-2-ol (PubChem CID 13099278) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (2S)-5,6,7,8-tetramethylidenebicyclo[2.2.2]octan-2-ol.
| Compound Name | (2S)-5,6,7,8-tetramethylidenebicyclo[2.2.2]octan-2-ol |
|---|---|
| PubChem CID | 13099278 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (2S)-5,6,7,8-tetramethylidenebicyclo[2.2.2]octan-2-ol |
| SMILES | C=C1C(=C)C2C(=C)C(=C)C1C[C@@H]2O |
| InChI | InChI=1S/C12H14O/c1-6-8(3)12-9(4)7(2)10(6)5-11(12)13/h10-13H,1-5H2/t10?,11-,12?/m0/s1 |
| InChIKey | QNWNDLVYGYQWIG-CXQJBGSLSA-N |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |