About (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride
(5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride (PubChem CID 130993046) has the molecular formula C6H9Cl2N3S2
and a molecular weight of 258.20 g/mol. Its IUPAC name is (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride |
| PubChem CID | 130993046 |
| Molecular Formula | C6H9Cl2N3S2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 256.96 |
| IUPAC Name | (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride |
| SMILES | C/N=C(\N)SCc1ncc(Cl)s1.Cl |
| InChI | InChI=1S/C6H8ClN3S2.ClH/c1-9-6(8)11-3-5-10-2-4(7)12-5;/h2H,3H2,1H3,(H2,8,9);1H |
| InChIKey | BKPCYBSYLYVWIP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride?
The IUPAC name of (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride (CID 130993046) is (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride.
What is the SMILES notation for (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride?
The canonical SMILES for (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride is C/N=C(\N)SCc1ncc(Cl)s1.Cl.
What is the InChIKey of (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride?
The InChIKey is BKPCYBSYLYVWIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClN3S2.ClH/c1-9-6(8)11-3-5-10-2-4(7)12-5;/h2H,3H2,1H3,(H2,8,9);1H.
What are the key properties of (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride?
(5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride has a molecular weight of 258.20 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-1,3-thiazol-2-yl)methyl N'-methylcarbamimidothioate;hydrochloride is sourced from PubChem (CID 130993046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).