C11H12N3OP — CID 13099655
3,7-dimethyl-5-phenyl-7aH-diazaphospholo[3,4-d][1,2,4]oxazaphosphole (PubChem CID 13099655) has the molecular formula C11H12N3OP and a molecular weight of 233.21 g/mol. Its IUPAC name is 3,7-dimethyl-5-phenyl-7aH-diazaphospholo[3,4-d][1,2,4]oxazaphosphole.
| Compound Name | 3,7-dimethyl-5-phenyl-7aH-diazaphospholo[3,4-d][1,2,4]oxazaphosphole |
|---|---|
| PubChem CID | 13099655 |
| Molecular Formula | C11H12N3OP |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3,7-dimethyl-5-phenyl-7aH-diazaphospholo[3,4-d][1,2,4]oxazaphosphole |
| SMILES | CC1=NN(c2ccccc2)P2C(C)=NOC12 |
| InChI | InChI=1S/C11H12N3OP/c1-8-11-15-13-9(2)16(11)14(12-8)10-6-4-3-5-7-10/h3-7,11H,1-2H3 |
| InChIKey | ZBNIFBFFOMDXNX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|