About 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one
2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one (PubChem CID 13099789) has the molecular formula C11H15N3OS
and a molecular weight of 237.33 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one.
Molecular Properties
| Compound Name | 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one |
| PubChem CID | 13099789 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one |
| SMILES | CN(C)CCCn1sc2cccnc2c1=O |
| InChI | InChI=1S/C11H15N3OS/c1-13(2)7-4-8-14-11(15)10-9(16-14)5-3-6-12-10/h3,5-6H,4,7-8H2,1-2H3 |
| InChIKey | MJKMWDAKDCLWBQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one?
The IUPAC name of 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one (CID 13099789) is 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one.
What is the SMILES notation for 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one?
The canonical SMILES for 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one is CN(C)CCCn1sc2cccnc2c1=O.
What is the InChIKey of 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one?
The InChIKey is MJKMWDAKDCLWBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3OS/c1-13(2)7-4-8-14-11(15)10-9(16-14)5-3-6-12-10/h3,5-6H,4,7-8H2,1-2H3.
What are the key properties of 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one?
2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one has a molecular weight of 237.33 g/mol, XLogP of 1.41, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(dimethylamino)propyl]-[1,2]thiazolo[4,5-b]pyridin-3-one is sourced from PubChem (CID 13099789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).