About 4-bromobenzeneselenolate
4-bromobenzeneselenolate (PubChem CID 13099932) has the molecular formula C6H4BrSe-
and a molecular weight of 234.96 g/mol. Its IUPAC name is 4-bromobenzeneselenolate.
Molecular Properties
| Compound Name | 4-bromobenzeneselenolate |
| PubChem CID | 13099932 |
| Molecular Formula | C6H4BrSe- |
| Molecular Weight | 234.96 g/mol |
| Exact Mass | 234.87 |
| IUPAC Name | 4-bromobenzeneselenolate |
| SMILES | [Se-]c1ccc(Br)cc1 |
| InChI | InChI=1S/C6H5BrSe/c7-5-1-3-6(8)4-2-5/h1-4,8H/p-1 |
| InChIKey | HMACDXNQOLCTRF-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.96 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobenzeneselenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobenzeneselenolate?
The IUPAC name of 4-bromobenzeneselenolate (CID 13099932) is 4-bromobenzeneselenolate.
What is the SMILES notation for 4-bromobenzeneselenolate?
The canonical SMILES for 4-bromobenzeneselenolate is [Se-]c1ccc(Br)cc1.
What is the InChIKey of 4-bromobenzeneselenolate?
The InChIKey is HMACDXNQOLCTRF-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5BrSe/c7-5-1-3-6(8)4-2-5/h1-4,8H/p-1.
What are the key properties of 4-bromobenzeneselenolate?
4-bromobenzeneselenolate has a molecular weight of 234.96 g/mol, XLogP of 1.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzeneselenolate is sourced from PubChem (CID 13099932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).