C19H16BrNO4S2 — CID 1309997
(5Z)-3-(4-bromophenyl)-2-sulfanylidene-5-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 1309997) has the molecular formula C19H16BrNO4S2 and a molecular weight of 466.38 g/mol. Its IUPAC name is (5Z)-3-(4-bromophenyl)-2-sulfanylidene-5-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(4-bromophenyl)-2-sulfanylidene-5-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1309997 |
| Molecular Formula | C19H16BrNO4S2 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 464.97 |
| IUPAC Name | (5Z)-3-(4-bromophenyl)-2-sulfanylidene-5-[(2,3,4-trimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2\SC(=S)N(c3ccc(Br)cc3)C2=O)c(OC)c1OC |
| InChI | InChI=1S/C19H16BrNO4S2/c1-23-14-9-4-11(16(24-2)17(14)25-3)10-15-18(22)21(19(26)27-15)13-7-5-12(20)6-8-13/h4-10H,1-3H3/b15-10- |
| InChIKey | KKIRUFFSDICSQP-GDNBJRDFSA-N |
| XLogP | 4.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|